C13H12F5NO2S2 — CID 150218065
4-butyl-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3,5-dicarbothioic S-acid (PubChem CID 150218065) has the molecular formula C13H12F5NO2S2 and a molecular weight of 373.37 g/mol. Its IUPAC name is 4-butyl-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3,5-dicarbothioic S-acid.
| Compound Name | 4-butyl-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3,5-dicarbothioic S-acid |
|---|---|
| PubChem CID | 150218065 |
| Molecular Formula | C13H12F5NO2S2 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.02 |
| IUPAC Name | 4-butyl-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3,5-dicarbothioic S-acid |
| SMILES | CCCCc1c(C(=O)S)c(C(F)F)nc(C(F)(F)F)c1C(=O)S |
| InChI | InChI=1S/C13H12F5NO2S2/c1-2-3-4-5-6(11(20)22)8(10(14)15)19-9(13(16,17)18)7(5)12(21)23/h10H,2-4H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | FSWZSIMYHAJTDI-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 47.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|