C14H14F5NOS — CID 59991749
2-[6-(difluoromethyl)-5-methyl-4-(2-methylpropyl)-2-(trifluoromethyl)-3-pyridinyl]-2-oxoethanethial (PubChem CID 59991749) has the molecular formula C14H14F5NOS and a molecular weight of 339.33 g/mol. Its IUPAC name is 2-[6-(difluoromethyl)-5-methyl-4-(2-methylpropyl)-2-(trifluoromethyl)-3-pyridinyl]-2-oxoethanethial.
| Compound Name | 2-[6-(difluoromethyl)-5-methyl-4-(2-methylpropyl)-2-(trifluoromethyl)-3-pyridinyl]-2-oxoethanethial |
|---|---|
| PubChem CID | 59991749 |
| Molecular Formula | C14H14F5NOS |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 2-[6-(difluoromethyl)-5-methyl-4-(2-methylpropyl)-2-(trifluoromethyl)-3-pyridinyl]-2-oxoethanethial |
| SMILES | Cc1c(C(F)F)nc(C(F)(F)F)c(C(=O)C=S)c1CC(C)C |
| InChI | InChI=1S/C14H14F5NOS/c1-6(2)4-8-7(3)11(13(15)16)20-12(14(17,18)19)10(8)9(21)5-22/h5-6,13H,4H2,1-3H3 |
| InChIKey | VEPZQFYLDFKKGA-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|