About 4-azido-1,1,1,2-tetrafluorobutane
4-azido-1,1,1,2-tetrafluorobutane (PubChem CID 150218662) has the molecular formula C4H5F4N3
and a molecular weight of 171.10 g/mol. Its IUPAC name is 4-azido-1,1,1,2-tetrafluorobutane.
Molecular Properties
| Compound Name | 4-azido-1,1,1,2-tetrafluorobutane |
| PubChem CID | 150218662 |
| Molecular Formula | C4H5F4N3 |
| Molecular Weight | 171.10 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | 4-azido-1,1,1,2-tetrafluorobutane |
| SMILES | [N-]=[N+]=NCCC(F)C(F)(F)F |
| InChI | InChI=1S/C4H5F4N3/c5-3(4(6,7)8)1-2-10-11-9/h3H,1-2H2 |
| InChIKey | FTAAHDULPVPHJT-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.10 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-azido-1,1,1,2-tetrafluorobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azido-1,1,1,2-tetrafluorobutane?
The IUPAC name of 4-azido-1,1,1,2-tetrafluorobutane (CID 150218662) is 4-azido-1,1,1,2-tetrafluorobutane.
What is the SMILES notation for 4-azido-1,1,1,2-tetrafluorobutane?
The canonical SMILES for 4-azido-1,1,1,2-tetrafluorobutane is [N-]=[N+]=NCCC(F)C(F)(F)F.
What is the InChIKey of 4-azido-1,1,1,2-tetrafluorobutane?
The InChIKey is FTAAHDULPVPHJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5F4N3/c5-3(4(6,7)8)1-2-10-11-9/h3H,1-2H2.
What are the key properties of 4-azido-1,1,1,2-tetrafluorobutane?
4-azido-1,1,1,2-tetrafluorobutane has a molecular weight of 171.10 g/mol, XLogP of 2.59, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azido-1,1,1,2-tetrafluorobutane is sourced from PubChem (CID 150218662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).