C8H9F3N4O2S — CID 171879530
4-azido-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butane-1,2-diol (PubChem CID 171879530) has the molecular formula C8H9F3N4O2S and a molecular weight of 282.25 g/mol. Its IUPAC name is 4-azido-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butane-1,2-diol.
| Compound Name | 4-azido-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butane-1,2-diol |
|---|---|
| PubChem CID | 171879530 |
| Molecular Formula | C8H9F3N4O2S |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 4-azido-1-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butane-1,2-diol |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C8H9F3N4O2S/c9-8(10,11)5-3-18-7(14-5)6(17)4(16)1-2-13-15-12/h3-4,6,16-17H,1-2H2 |
| InChIKey | DFSDOBYQHNDQGE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 102.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|