C7H5F3N2O2S — CID 171870295
2,3-dihydroxy-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]propanenitrile (PubChem CID 171870295) has the molecular formula C7H5F3N2O2S and a molecular weight of 238.19 g/mol. Its IUPAC name is 2,3-dihydroxy-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]propanenitrile.
| Compound Name | 2,3-dihydroxy-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]propanenitrile |
|---|---|
| PubChem CID | 171870295 |
| Molecular Formula | C7H5F3N2O2S |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | 2,3-dihydroxy-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]propanenitrile |
| SMILES | N#CC(O)C(O)c1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C7H5F3N2O2S/c8-7(9,10)4-2-15-6(12-4)5(14)3(13)1-11/h2-3,5,13-14H |
| InChIKey | XNUYYYXVHJQIER-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|