C14H8F3IN2OS — CID 167895347
4-(4-iodophenyl)-3-oxo-2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butanenitrile (PubChem CID 167895347) has the molecular formula C14H8F3IN2OS and a molecular weight of 436.20 g/mol. Its IUPAC name is 4-(4-iodophenyl)-3-oxo-2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butanenitrile.
| Compound Name | 4-(4-iodophenyl)-3-oxo-2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butanenitrile |
|---|---|
| PubChem CID | 167895347 |
| Molecular Formula | C14H8F3IN2OS |
| Molecular Weight | 436.20 g/mol |
| Exact Mass | 435.94 |
| IUPAC Name | 4-(4-iodophenyl)-3-oxo-2-[4-(trifluoromethyl)-1,3-thiazol-2-yl]butanenitrile |
| SMILES | N#CC(C(=O)Cc1ccc(I)cc1)c1nc(C(F)(F)F)cs1 |
| InChI | InChI=1S/C14H8F3IN2OS/c15-14(16,17)12-7-22-13(20-12)10(6-19)11(21)5-8-1-3-9(18)4-2-8/h1-4,7,10H,5H2 |
| InChIKey | LAXOQQBUYMTYPZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.20 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|