C21H18ClNO6 — CID 15022005
5-[(4-chloro-3-methoxy-1-oxoisochromen-7-yl)amino]-5-oxo-3-phenylpentanoic acid (PubChem CID 15022005) has the molecular formula C21H18ClNO6 and a molecular weight of 415.83 g/mol. Its IUPAC name is 5-[(4-chloro-3-methoxy-1-oxoisochromen-7-yl)amino]-5-oxo-3-phenylpentanoic acid.
| Compound Name | 5-[(4-chloro-3-methoxy-1-oxoisochromen-7-yl)amino]-5-oxo-3-phenylpentanoic acid |
|---|---|
| PubChem CID | 15022005 |
| Molecular Formula | C21H18ClNO6 |
| Molecular Weight | 415.83 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 5-[(4-chloro-3-methoxy-1-oxoisochromen-7-yl)amino]-5-oxo-3-phenylpentanoic acid |
| SMILES | COc1oc(=O)c2cc(NC(=O)CC(CC(=O)O)c3ccccc3)ccc2c1Cl |
| InChI | InChI=1S/C21H18ClNO6/c1-28-21-19(22)15-8-7-14(11-16(15)20(27)29-21)23-17(24)9-13(10-18(25)26)12-5-3-2-4-6-12/h2-8,11,13H,9-10H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | MRUHKADDNPNMRA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.83 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |