C20H19ClN2O4 — CID 91953209
3-(4-chlorophenyl)-5-[(2-methyl-3-oxo-1H-isoindol-5-yl)amino]-5-oxopentanoic acid (PubChem CID 91953209) has the molecular formula C20H19ClN2O4 and a molecular weight of 386.84 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5-[(2-methyl-3-oxo-1H-isoindol-5-yl)amino]-5-oxopentanoic acid.
| Compound Name | 3-(4-chlorophenyl)-5-[(2-methyl-3-oxo-1H-isoindol-5-yl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 91953209 |
| Molecular Formula | C20H19ClN2O4 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 3-(4-chlorophenyl)-5-[(2-methyl-3-oxo-1H-isoindol-5-yl)amino]-5-oxopentanoic acid |
| SMILES | CN1Cc2ccc(NC(=O)CC(CC(=O)O)c3ccc(Cl)cc3)cc2C1=O |
| InChI | InChI=1S/C20H19ClN2O4/c1-23-11-13-4-7-16(10-17(13)20(23)27)22-18(24)8-14(9-19(25)26)12-2-5-15(21)6-3-12/h2-7,10,14H,8-9,11H2,1H3,(H,22,24)(H,25,26) |
| InChIKey | JNKUVZNULLAOFO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |