C37H28Cl2N2O6 — CID 57206014
phenyl 2-chloro-4-[[5-(3-chloro-4-phenoxycarbonylanilino)-5-oxo-3-phenylpentanoyl]amino]benzoate (PubChem CID 57206014) has the molecular formula C37H28Cl2N2O6 and a molecular weight of 667.55 g/mol. Its IUPAC name is phenyl 2-chloro-4-[[5-(3-chloro-4-phenoxycarbonylanilino)-5-oxo-3-phenylpentanoyl]amino]benzoate.
| Compound Name | phenyl 2-chloro-4-[[5-(3-chloro-4-phenoxycarbonylanilino)-5-oxo-3-phenylpentanoyl]amino]benzoate |
|---|---|
| PubChem CID | 57206014 |
| Molecular Formula | C37H28Cl2N2O6 |
| Molecular Weight | 667.55 g/mol |
| Exact Mass | 666.13 |
| IUPAC Name | phenyl 2-chloro-4-[[5-(3-chloro-4-phenoxycarbonylanilino)-5-oxo-3-phenylpentanoyl]amino]benzoate |
| SMILES | O=C(CC(CC(=O)Nc1ccc(C(=O)Oc2ccccc2)c(Cl)c1)c1ccccc1)Nc1ccc(C(=O)Oc2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C37H28Cl2N2O6/c38-32-22-26(16-18-30(32)36(44)46-28-12-6-2-7-13-28)40-34(42)20-25(24-10-4-1-5-11-24)21-35(43)41-27-17-19-31(33(39)23-27)37(45)47-29-14-8-3-9-15-29/h1-19,22-23,25H,20-21H2,(H,40,42)(H,41,43) |
| InChIKey | BQBZKVYJOCLHPN-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.55 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|