C27H22Cl2N4O8 — CID 18541422
N,N'-bis[3-chloro-4-(2-nitroacetyl)phenyl]-3-phenylpentanediamide (PubChem CID 18541422) has the molecular formula C27H22Cl2N4O8 and a molecular weight of 601.40 g/mol. Its IUPAC name is N,N'-bis[3-chloro-4-(2-nitroacetyl)phenyl]-3-phenylpentanediamide.
| Compound Name | N,N'-bis[3-chloro-4-(2-nitroacetyl)phenyl]-3-phenylpentanediamide |
|---|---|
| PubChem CID | 18541422 |
| Molecular Formula | C27H22Cl2N4O8 |
| Molecular Weight | 601.40 g/mol |
| Exact Mass | 600.08 |
| IUPAC Name | N,N'-bis[3-chloro-4-(2-nitroacetyl)phenyl]-3-phenylpentanediamide |
| SMILES | O=C(CC(CC(=O)Nc1ccc(C(=O)C[N+](=O)[O-])c(Cl)c1)c1ccccc1)Nc1ccc(C(=O)C[N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C27H22Cl2N4O8/c28-22-12-18(6-8-20(22)24(34)14-32(38)39)30-26(36)10-17(16-4-2-1-3-5-16)11-27(37)31-19-7-9-21(23(29)13-19)25(35)15-33(40)41/h1-9,12-13,17H,10-11,14-15H2,(H,30,36)(H,31,37) |
| InChIKey | KSKFLYQAXMTWHE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 178.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.40 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|