C10H26N2O3Si — CID 150228129
5-[dimethoxy(methyl)silyl]-1-N-ethoxypentane-1,3-diamine (PubChem CID 150228129) has the molecular formula C10H26N2O3Si and a molecular weight of 250.41 g/mol. Its IUPAC name is 5-[dimethoxy(methyl)silyl]-1-N-ethoxypentane-1,3-diamine.
| Compound Name | 5-[dimethoxy(methyl)silyl]-1-N-ethoxypentane-1,3-diamine |
|---|---|
| PubChem CID | 150228129 |
| Molecular Formula | C10H26N2O3Si |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 5-[dimethoxy(methyl)silyl]-1-N-ethoxypentane-1,3-diamine |
| SMILES | CCONCCC(N)CC[Si](C)(OC)OC |
| InChI | InChI=1S/C10H26N2O3Si/c1-5-15-12-8-6-10(11)7-9-16(4,13-2)14-3/h10,12H,5-9,11H2,1-4H3 |
| InChIKey | FUWXYVGKCHONKB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|