C8H14S2 — CID 150231509
octa-1,7-diene-2,6-dithiol (PubChem CID 150231509) has the molecular formula C8H14S2 and a molecular weight of 174.33 g/mol. Its IUPAC name is octa-1,7-diene-2,6-dithiol.
| Compound Name | octa-1,7-diene-2,6-dithiol |
|---|---|
| PubChem CID | 150231509 |
| Molecular Formula | C8H14S2 |
| Molecular Weight | 174.33 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | octa-1,7-diene-2,6-dithiol |
| SMILES | C=CC(S)CCCC(=C)S |
| InChI | InChI=1S/C8H14S2/c1-3-8(10)6-4-5-7(2)9/h3,8-10H,1-2,4-6H2 |
| InChIKey | FVOSZMPEBYVAEJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|