About 4-ethenyloctanedioate
4-ethenyloctanedioate (PubChem CID 18371106) has the molecular formula C10H14O4-2
and a molecular weight of 198.22 g/mol. Its IUPAC name is 4-ethenyloctanedioate.
Molecular Properties
| Compound Name | 4-ethenyloctanedioate |
| PubChem CID | 18371106 |
| Molecular Formula | C10H14O4-2 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 4-ethenyloctanedioate |
| SMILES | C=CC(CCCC(=O)[O-])CCC(=O)[O-] |
| InChI | InChI=1S/C10H16O4/c1-2-8(6-7-10(13)14)4-3-5-9(11)12/h2,8H,1,3-7H2,(H,11,12)(H,13,14)/p-2 |
| InChIKey | IXSJMKYVUBOOAU-UHFFFAOYSA-L |
| XLogP | -0.76 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-ethenyloctanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethenyloctanedioate?
The IUPAC name of 4-ethenyloctanedioate (CID 18371106) is 4-ethenyloctanedioate.
What is the SMILES notation for 4-ethenyloctanedioate?
The canonical SMILES for 4-ethenyloctanedioate is C=CC(CCCC(=O)[O-])CCC(=O)[O-].
What is the InChIKey of 4-ethenyloctanedioate?
The InChIKey is IXSJMKYVUBOOAU-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H16O4/c1-2-8(6-7-10(13)14)4-3-5-9(11)12/h2,8H,1,3-7H2,(H,11,12)(H,13,14)/p-2.
What are the key properties of 4-ethenyloctanedioate?
4-ethenyloctanedioate has a molecular weight of 198.22 g/mol, XLogP of -0.76, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethenyloctanedioate is sourced from PubChem (CID 18371106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).