C19H17F6NO5S2 — CID 150241307
N-[1,1,1,5,5,5-hexafluoro-2,4-bis(4-methylsulfonylphenyl)pentan-3-ylidene]hydroxylamine (PubChem CID 150241307) has the molecular formula C19H17F6NO5S2 and a molecular weight of 517.47 g/mol. Its IUPAC name is N-[1,1,1,5,5,5-hexafluoro-2,4-bis(4-methylsulfonylphenyl)pentan-3-ylidene]hydroxylamine.
| Compound Name | N-[1,1,1,5,5,5-hexafluoro-2,4-bis(4-methylsulfonylphenyl)pentan-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 150241307 |
| Molecular Formula | C19H17F6NO5S2 |
| Molecular Weight | 517.47 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | N-[1,1,1,5,5,5-hexafluoro-2,4-bis(4-methylsulfonylphenyl)pentan-3-ylidene]hydroxylamine |
| SMILES | CS(=O)(=O)c1ccc(C(C(=NO)C(c2ccc(S(C)(=O)=O)cc2)C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F6NO5S2/c1-32(28,29)13-7-3-11(4-8-13)15(18(20,21)22)17(26-27)16(19(23,24)25)12-5-9-14(10-6-12)33(2,30)31/h3-10,15-16,27H,1-2H3 |
| InChIKey | FXPAMICPAHWUAP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.47 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|