C21H21F6NO5 — CID 150979682
N-[2,4-bis(3,4-dimethoxyphenyl)-1,1,1,5,5,5-hexafluoropentan-3-ylidene]hydroxylamine (PubChem CID 150979682) has the molecular formula C21H21F6NO5 and a molecular weight of 481.39 g/mol. Its IUPAC name is N-[2,4-bis(3,4-dimethoxyphenyl)-1,1,1,5,5,5-hexafluoropentan-3-ylidene]hydroxylamine.
| Compound Name | N-[2,4-bis(3,4-dimethoxyphenyl)-1,1,1,5,5,5-hexafluoropentan-3-ylidene]hydroxylamine |
|---|---|
| PubChem CID | 150979682 |
| Molecular Formula | C21H21F6NO5 |
| Molecular Weight | 481.39 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | N-[2,4-bis(3,4-dimethoxyphenyl)-1,1,1,5,5,5-hexafluoropentan-3-ylidene]hydroxylamine |
| SMILES | COc1ccc(C(C(=NO)C(c2ccc(OC)c(OC)c2)C(F)(F)F)C(F)(F)F)cc1OC |
| InChI | InChI=1S/C21H21F6NO5/c1-30-13-7-5-11(9-15(13)32-3)17(20(22,23)24)19(28-29)18(21(25,26)27)12-6-8-14(31-2)16(10-12)33-4/h5-10,17-18,29H,1-4H3 |
| InChIKey | LPVDZEWFLRQEPN-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.39 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|