C11H13F8N3 — CID 150282244
3-hexyl-5-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-1,2,4-triazole (PubChem CID 150282244) has the molecular formula C11H13F8N3 and a molecular weight of 339.23 g/mol. Its IUPAC name is 3-hexyl-5-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-1,2,4-triazole.
| Compound Name | 3-hexyl-5-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 150282244 |
| Molecular Formula | C11H13F8N3 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 3-hexyl-5-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-1,2,4-triazole |
| SMILES | CCCCCCc1nnc(C(F)(F)C(F)(F)F)n1C(F)(F)F |
| InChI | InChI=1S/C11H13F8N3/c1-2-3-4-5-6-7-20-21-8(22(7)11(17,18)19)9(12,13)10(14,15)16/h2-6H2,1H3 |
| InChIKey | GFVLNBMCHRLRII-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|