C11H17ClF3N3 — CID 10401599
1-(2-chloropropan-2-yl)-5-pentyl-3-(trifluoromethyl)-1,2,4-triazole (PubChem CID 10401599) has the molecular formula C11H17ClF3N3 and a molecular weight of 283.73 g/mol. Its IUPAC name is 1-(2-chloropropan-2-yl)-5-pentyl-3-(trifluoromethyl)-1,2,4-triazole.
| Compound Name | 1-(2-chloropropan-2-yl)-5-pentyl-3-(trifluoromethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 10401599 |
| Molecular Formula | C11H17ClF3N3 |
| Molecular Weight | 283.73 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 1-(2-chloropropan-2-yl)-5-pentyl-3-(trifluoromethyl)-1,2,4-triazole |
| SMILES | CCCCCc1nc(C(F)(F)F)nn1C(C)(C)Cl |
| InChI | InChI=1S/C11H17ClF3N3/c1-4-5-6-7-8-16-9(11(13,14)15)17-18(8)10(2,3)12/h4-7H2,1-3H3 |
| InChIKey | MRNHRQBEDFHPHF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.73 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|