C10H13ClF5N3 — CID 151133373
3-chloro-5-hexyl-4-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazole (PubChem CID 151133373) has the molecular formula C10H13ClF5N3 and a molecular weight of 305.68 g/mol. Its IUPAC name is 3-chloro-5-hexyl-4-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazole.
| Compound Name | 3-chloro-5-hexyl-4-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 151133373 |
| Molecular Formula | C10H13ClF5N3 |
| Molecular Weight | 305.68 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 3-chloro-5-hexyl-4-(1,1,2,2,2-pentafluoroethyl)-1,2,4-triazole |
| SMILES | CCCCCCc1nnc(Cl)n1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H13ClF5N3/c1-2-3-4-5-6-7-17-18-8(11)19(7)10(15,16)9(12,13)14/h2-6H2,1H3 |
| InChIKey | MURWTCWSZXQCGU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.68 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|