C12H6F17N3 — CID 123138478
3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-4,5-dimethyl-1,2,4-triazole (PubChem CID 123138478) has the molecular formula C12H6F17N3 and a molecular weight of 515.17 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-4,5-dimethyl-1,2,4-triazole.
| Compound Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-4,5-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 123138478 |
| Molecular Formula | C12H6F17N3 |
| Molecular Weight | 515.17 g/mol |
| Exact Mass | 515.03 |
| IUPAC Name | 3-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)-4,5-dimethyl-1,2,4-triazole |
| SMILES | Cc1nnc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)n1C |
| InChI | InChI=1S/C12H6F17N3/c1-3-30-31-4(32(3)2)5(13,14)6(15,16)7(17,18)8(19,20)9(21,22)10(23,24)11(25,26)12(27,28)29/h1-2H3 |
| InChIKey | HIFSIBIJBUOFLQ-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.17 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|