C13H10F15N3O — CID 11168140
3-methoxy-5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1-propyl-1,2,4-triazole (PubChem CID 11168140) has the molecular formula C13H10F15N3O and a molecular weight of 509.21 g/mol. Its IUPAC name is 3-methoxy-5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1-propyl-1,2,4-triazole.
| Compound Name | 3-methoxy-5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1-propyl-1,2,4-triazole |
|---|---|
| PubChem CID | 11168140 |
| Molecular Formula | C13H10F15N3O |
| Molecular Weight | 509.21 g/mol |
| Exact Mass | 509.06 |
| IUPAC Name | 3-methoxy-5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1-propyl-1,2,4-triazole |
| SMILES | CCCn1nc(OC)nc1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H10F15N3O/c1-3-4-31-5(29-6(30-31)32-2)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)28/h3-4H2,1-2H3 |
| InChIKey | CYOSXBMPARMLIW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.21 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|