C11H6F15N3O — CID 11752000
3-methoxy-1-methyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,2,4-triazole (PubChem CID 11752000) has the molecular formula C11H6F15N3O and a molecular weight of 481.16 g/mol. Its IUPAC name is 3-methoxy-1-methyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,2,4-triazole.
| Compound Name | 3-methoxy-1-methyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 11752000 |
| Molecular Formula | C11H6F15N3O |
| Molecular Weight | 481.16 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | 3-methoxy-1-methyl-5-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,2,4-triazole |
| SMILES | COc1nc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)n(C)n1 |
| InChI | InChI=1S/C11H6F15N3O/c1-29-3(27-4(28-29)30-2)5(12,13)6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)26/h1-2H3 |
| InChIKey | GMBJMVGGSDHTLY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.16 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|