C10H18N3- — CID 102349376
3,5-dibutyl-1,2-diaza-4-azanidacyclopenta-2,5-diene (PubChem CID 102349376) has the molecular formula C10H18N3- and a molecular weight of 180.28 g/mol. Its IUPAC name is 3,5-dibutyl-1,2-diaza-4-azanidacyclopenta-2,5-diene.
| Compound Name | 3,5-dibutyl-1,2-diaza-4-azanidacyclopenta-2,5-diene |
|---|---|
| PubChem CID | 102349376 |
| Molecular Formula | C10H18N3- |
| Molecular Weight | 180.28 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 3,5-dibutyl-1,2-diaza-4-azanidacyclopenta-2,5-diene |
| SMILES | CCCCc1nnc(CCCC)[n-]1 |
| InChI | InChI=1S/C10H18N3/c1-3-5-7-9-11-10(13-12-9)8-6-4-2/h3-8H2,1-2H3/q-1 |
| InChIKey | VVQMFHMYQBIBRI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 39.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |