C8H9Cl3F3N3 — CID 150492734
3-butyl-5-(trichloromethyl)-4-(trifluoromethyl)-1,2,4-triazole (PubChem CID 150492734) has the molecular formula C8H9Cl3F3N3 and a molecular weight of 310.53 g/mol. Its IUPAC name is 3-butyl-5-(trichloromethyl)-4-(trifluoromethyl)-1,2,4-triazole.
| Compound Name | 3-butyl-5-(trichloromethyl)-4-(trifluoromethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 150492734 |
| Molecular Formula | C8H9Cl3F3N3 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 3-butyl-5-(trichloromethyl)-4-(trifluoromethyl)-1,2,4-triazole |
| SMILES | CCCCc1nnc(C(Cl)(Cl)Cl)n1C(F)(F)F |
| InChI | InChI=1S/C8H9Cl3F3N3/c1-2-3-4-5-15-16-6(7(9,10)11)17(5)8(12,13)14/h2-4H2,1H3 |
| InChIKey | HWDCKFVFAOCGEV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|