C9H9F8N3 — CID 151682538
3-butyl-5-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-1,2,4-triazole (PubChem CID 151682538) has the molecular formula C9H9F8N3 and a molecular weight of 311.18 g/mol. Its IUPAC name is 3-butyl-5-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-1,2,4-triazole.
| Compound Name | 3-butyl-5-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 151682538 |
| Molecular Formula | C9H9F8N3 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 3-butyl-5-(1,1,2,2,2-pentafluoroethyl)-4-(trifluoromethyl)-1,2,4-triazole |
| SMILES | CCCCc1nnc(C(F)(F)C(F)(F)F)n1C(F)(F)F |
| InChI | InChI=1S/C9H9F8N3/c1-2-3-4-5-18-19-6(20(5)9(15,16)17)7(10,11)8(12,13)14/h2-4H2,1H3 |
| InChIKey | RAVNPNHFZJRAHT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|