C16H21NO4S — CID 150287018
octan-3-yl 4-hydroxy-6-oxo-7H-thieno[2,3-b]pyridine-5-carboxylate (PubChem CID 150287018) has the molecular formula C16H21NO4S and a molecular weight of 323.41 g/mol. Its IUPAC name is octan-3-yl 4-hydroxy-6-oxo-7H-thieno[2,3-b]pyridine-5-carboxylate.
| Compound Name | octan-3-yl 4-hydroxy-6-oxo-7H-thieno[2,3-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 150287018 |
| Molecular Formula | C16H21NO4S |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | octan-3-yl 4-hydroxy-6-oxo-7H-thieno[2,3-b]pyridine-5-carboxylate |
| SMILES | CCCCCC(CC)OC(=O)c1c(O)c2ccsc2[nH]c1=O |
| InChI | InChI=1S/C16H21NO4S/c1-3-5-6-7-10(4-2)21-16(20)12-13(18)11-8-9-22-15(11)17-14(12)19/h8-10H,3-7H2,1-2H3,(H2,17,18,19) |
| InChIKey | GGUIFEMXMKEJIN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 79.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|