C6H8F3NO3S — CID 150291440
N-(1,1-dioxothiolan-2-yl)-2,2,2-trifluoroacetamide (PubChem CID 150291440) has the molecular formula C6H8F3NO3S and a molecular weight of 231.19 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-2-yl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(1,1-dioxothiolan-2-yl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 150291440 |
| Molecular Formula | C6H8F3NO3S |
| Molecular Weight | 231.19 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | N-(1,1-dioxothiolan-2-yl)-2,2,2-trifluoroacetamide |
| SMILES | O=C(NC1CCCS1(=O)=O)C(F)(F)F |
| InChI | InChI=1S/C6H8F3NO3S/c7-6(8,9)5(11)10-4-2-1-3-14(4,12)13/h4H,1-3H2,(H,10,11) |
| InChIKey | GHRCENLZLPTIHL-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.19 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |