C20H17F4N3O2 — CID 150296380
2-[4-(2-fluoro-3-pyridinyl)phenyl]-N-[5-(1,1,1-trifluoro-2-methylpropan-2-yl)-1,2-oxazol-3-yl]acetamide (PubChem CID 150296380) has the molecular formula C20H17F4N3O2 and a molecular weight of 407.37 g/mol. Its IUPAC name is 2-[4-(2-fluoro-3-pyridinyl)phenyl]-N-[5-(1,1,1-trifluoro-2-methylpropan-2-yl)-1,2-oxazol-3-yl]acetamide.
| Compound Name | 2-[4-(2-fluoro-3-pyridinyl)phenyl]-N-[5-(1,1,1-trifluoro-2-methylpropan-2-yl)-1,2-oxazol-3-yl]acetamide |
|---|---|
| PubChem CID | 150296380 |
| Molecular Formula | C20H17F4N3O2 |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 2-[4-(2-fluoro-3-pyridinyl)phenyl]-N-[5-(1,1,1-trifluoro-2-methylpropan-2-yl)-1,2-oxazol-3-yl]acetamide |
| SMILES | CC(C)(c1cc(NC(=O)Cc2ccc(-c3cccnc3F)cc2)no1)C(F)(F)F |
| InChI | InChI=1S/C20H17F4N3O2/c1-19(2,20(22,23)24)15-11-16(27-29-15)26-17(28)10-12-5-7-13(8-6-12)14-4-3-9-25-18(14)21/h3-9,11H,10H2,1-2H3,(H,26,27,28) |
| InChIKey | GIRAMTNZAFFEKF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|