C15H22O3 — CID 15031561
9,12-dimethoxybicyclo[7.3.1]trideca-1(13),11-dien-10-one (PubChem CID 15031561) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 9,12-dimethoxybicyclo[7.3.1]trideca-1(13),11-dien-10-one.
| Compound Name | 9,12-dimethoxybicyclo[7.3.1]trideca-1(13),11-dien-10-one |
|---|---|
| PubChem CID | 15031561 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 9,12-dimethoxybicyclo[7.3.1]trideca-1(13),11-dien-10-one |
| SMILES | COC1=CC(=O)C2(OC)C=C1CCCCCCC2 |
| InChI | InChI=1S/C15H22O3/c1-17-13-10-14(16)15(18-2)9-7-5-3-4-6-8-12(13)11-15/h10-11H,3-9H2,1-2H3 |
| InChIKey | JIMRXFAZFYMTAJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |