C21H28O3 — CID 11336418
(5R,8S)-2-methoxy-3,8-dimethyl-5-[(2S,4E)-6-methylhepta-4,6-dien-2-yl]-5,6,7,8-tetrahydronaphthalene-1,4-dione (PubChem CID 11336418) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (5R,8S)-2-methoxy-3,8-dimethyl-5-[(2S,4E)-6-methylhepta-4,6-dien-2-yl]-5,6,7,8-tetrahydronaphthalene-1,4-dione.
| Compound Name | (5R,8S)-2-methoxy-3,8-dimethyl-5-[(2S,4E)-6-methylhepta-4,6-dien-2-yl]-5,6,7,8-tetrahydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 11336418 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (5R,8S)-2-methoxy-3,8-dimethyl-5-[(2S,4E)-6-methylhepta-4,6-dien-2-yl]-5,6,7,8-tetrahydronaphthalene-1,4-dione |
| SMILES | C=C(C)/C=C/C[C@H](C)[C@H]1CC[C@H](C)C2=C1C(=O)C(C)=C(OC)C2=O |
| InChI | InChI=1S/C21H28O3/c1-12(2)8-7-9-13(3)16-11-10-14(4)17-18(16)19(22)15(5)21(24-6)20(17)23/h7-8,13-14,16H,1,9-11H2,2-6H3/b8-7+/t13-,14-,16+/m0/s1 |
| InChIKey | KSDPIOPGEKTIFE-LERLDDTHSA-N |
| XLogP | 4.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|