C14H25NO — CID 15032156
2-ethenyl-N-(2,4,4-trimethylpentan-2-yl)cyclopropane-1-carboxamide (PubChem CID 15032156) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is 2-ethenyl-N-(2,4,4-trimethylpentan-2-yl)cyclopropane-1-carboxamide.
| Compound Name | 2-ethenyl-N-(2,4,4-trimethylpentan-2-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 15032156 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | 2-ethenyl-N-(2,4,4-trimethylpentan-2-yl)cyclopropane-1-carboxamide |
| SMILES | C=CC1CC1C(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C14H25NO/c1-7-10-8-11(10)12(16)15-14(5,6)9-13(2,3)4/h7,10-11H,1,8-9H2,2-6H3,(H,15,16) |
| InChIKey | NQYVBYVFUIVTPT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|