C12H23NO — CID 20790242
N-tert-butyl-2-propan-2-ylpent-4-enamide (PubChem CID 20790242) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is N-tert-butyl-2-propan-2-ylpent-4-enamide.
| Compound Name | N-tert-butyl-2-propan-2-ylpent-4-enamide |
|---|---|
| PubChem CID | 20790242 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | N-tert-butyl-2-propan-2-ylpent-4-enamide |
| SMILES | C=CCC(C(=O)NC(C)(C)C)C(C)C |
| InChI | InChI=1S/C12H23NO/c1-7-8-10(9(2)3)11(14)13-12(4,5)6/h7,9-10H,1,8H2,2-6H3,(H,13,14) |
| InChIKey | SRHDAHJBPQNYQJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|