C18H34O2Si — CID 150325316
(2Z)-2-[(4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-ylidene]ethanol (PubChem CID 150325316) has the molecular formula C18H34O2Si and a molecular weight of 310.55 g/mol. Its IUPAC name is (2Z)-2-[(4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-ylidene]ethanol.
| Compound Name | (2Z)-2-[(4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-ylidene]ethanol |
|---|---|
| PubChem CID | 150325316 |
| Molecular Formula | C18H34O2Si |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (2Z)-2-[(4S,7aS)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-3,3a,4,5,6,7-hexahydro-2H-inden-1-ylidene]ethanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCC[C@]2(C)/C(=C\CO)CCC12 |
| InChI | InChI=1S/C18H34O2Si/c1-17(2,3)21(5,6)20-16-8-7-12-18(4)14(11-13-19)9-10-15(16)18/h11,15-16,19H,7-10,12-13H2,1-6H3/b14-11-/t15?,16-,18+/m0/s1 |
| InChIKey | GOMVGIYJJSGYLS-FKJXQYTKSA-N |
| XLogP | 4.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|