C12H12ClNO2S2 — CID 15033465
3-(4-chlorophenoxy)-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)propan-1-one (PubChem CID 15033465) has the molecular formula C12H12ClNO2S2 and a molecular weight of 301.82 g/mol. Its IUPAC name is 3-(4-chlorophenoxy)-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)propan-1-one.
| Compound Name | 3-(4-chlorophenoxy)-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)propan-1-one |
|---|---|
| PubChem CID | 15033465 |
| Molecular Formula | C12H12ClNO2S2 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 3-(4-chlorophenoxy)-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)propan-1-one |
| SMILES | O=C(CCOc1ccc(Cl)cc1)N1CCSC1=S |
| InChI | InChI=1S/C12H12ClNO2S2/c13-9-1-3-10(4-2-9)16-7-5-11(15)14-6-8-18-12(14)17/h1-4H,5-8H2 |
| InChIKey | VNIYUYOHJCQFRE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|