C24H35NO2 — CID 150339943
3,6-dimethyl-4-pentan-3-yloxy-2-(2,4,6-triethylphenoxy)pyridine (PubChem CID 150339943) has the molecular formula C24H35NO2 and a molecular weight of 369.55 g/mol. Its IUPAC name is 3,6-dimethyl-4-pentan-3-yloxy-2-(2,4,6-triethylphenoxy)pyridine.
| Compound Name | 3,6-dimethyl-4-pentan-3-yloxy-2-(2,4,6-triethylphenoxy)pyridine |
|---|---|
| PubChem CID | 150339943 |
| Molecular Formula | C24H35NO2 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.27 |
| IUPAC Name | 3,6-dimethyl-4-pentan-3-yloxy-2-(2,4,6-triethylphenoxy)pyridine |
| SMILES | CCc1cc(CC)c(Oc2nc(C)cc(OC(CC)CC)c2C)c(CC)c1 |
| InChI | InChI=1S/C24H35NO2/c1-8-18-14-19(9-2)23(20(10-3)15-18)27-24-17(7)22(13-16(6)25-24)26-21(11-4)12-5/h13-15,21H,8-12H2,1-7H3 |
| InChIKey | GRMNBEDWYDKXCT-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |