C23H16ClFN4O3 — CID 15035149
1-[6-chloro-4-(2-methylphenyl)quinolin-3-yl]-3-(4-fluoro-3-nitrophenyl)urea (PubChem CID 15035149) has the molecular formula C23H16ClFN4O3 and a molecular weight of 450.86 g/mol. Its IUPAC name is 1-[6-chloro-4-(2-methylphenyl)quinolin-3-yl]-3-(4-fluoro-3-nitrophenyl)urea.
| Compound Name | 1-[6-chloro-4-(2-methylphenyl)quinolin-3-yl]-3-(4-fluoro-3-nitrophenyl)urea |
|---|---|
| PubChem CID | 15035149 |
| Molecular Formula | C23H16ClFN4O3 |
| Molecular Weight | 450.86 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 1-[6-chloro-4-(2-methylphenyl)quinolin-3-yl]-3-(4-fluoro-3-nitrophenyl)urea |
| SMILES | Cc1ccccc1-c1c(NC(=O)Nc2ccc(F)c([N+](=O)[O-])c2)cnc2ccc(Cl)cc12 |
| InChI | InChI=1S/C23H16ClFN4O3/c1-13-4-2-3-5-16(13)22-17-10-14(24)6-9-19(17)26-12-20(22)28-23(30)27-15-7-8-18(25)21(11-15)29(31)32/h2-12H,1H3,(H2,27,28,30) |
| InChIKey | YEYUPPACBPQBIJ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.86 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|