C13H20O2S — CID 150353043
4-(1-butylsulfanylpropyl)benzene-1,2-diol (PubChem CID 150353043) has the molecular formula C13H20O2S and a molecular weight of 240.37 g/mol. Its IUPAC name is 4-(1-butylsulfanylpropyl)benzene-1,2-diol.
| Compound Name | 4-(1-butylsulfanylpropyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 150353043 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 4-(1-butylsulfanylpropyl)benzene-1,2-diol |
| SMILES | CCCCSC(CC)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H20O2S/c1-3-5-8-16-13(4-2)10-6-7-11(14)12(15)9-10/h6-7,9,13-15H,3-5,8H2,1-2H3 |
| InChIKey | GUDHQGIISZBRIP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|