C16H15N3O — CID 150361115
pyrrolidin-1-yl(pyrrolo[1,2-a]quinoxalin-6-yl)methanone (PubChem CID 150361115) has the molecular formula C16H15N3O and a molecular weight of 265.32 g/mol. Its IUPAC name is pyrrolidin-1-yl(pyrrolo[1,2-a]quinoxalin-6-yl)methanone.
| Compound Name | pyrrolidin-1-yl(pyrrolo[1,2-a]quinoxalin-6-yl)methanone |
|---|---|
| PubChem CID | 150361115 |
| Molecular Formula | C16H15N3O |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | pyrrolidin-1-yl(pyrrolo[1,2-a]quinoxalin-6-yl)methanone |
| SMILES | O=C(c1cccc2c1ncc1cccn12)N1CCCC1 |
| InChI | InChI=1S/C16H15N3O/c20-16(18-8-1-2-9-18)13-6-3-7-14-15(13)17-11-12-5-4-10-19(12)14/h3-7,10-11H,1-2,8-9H2 |
| InChIKey | GVSPVUVKZUUSLL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |