C13H13F4NO3 — CID 150361272
3-[[3-(2,2,3,3-tetrafluoro-1-hydroxypropyl)phenyl]methyl]-1,3-oxazolidin-2-one (PubChem CID 150361272) has the molecular formula C13H13F4NO3 and a molecular weight of 307.24 g/mol. Its IUPAC name is 3-[[3-(2,2,3,3-tetrafluoro-1-hydroxypropyl)phenyl]methyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[[3-(2,2,3,3-tetrafluoro-1-hydroxypropyl)phenyl]methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 150361272 |
| Molecular Formula | C13H13F4NO3 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 3-[[3-(2,2,3,3-tetrafluoro-1-hydroxypropyl)phenyl]methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1Cc1cccc(C(O)C(F)(F)C(F)F)c1 |
| InChI | InChI=1S/C13H13F4NO3/c14-11(15)13(16,17)10(19)9-3-1-2-8(6-9)7-18-4-5-21-12(18)20/h1-3,6,10-11,19H,4-5,7H2 |
| InChIKey | GVTMHCWXXMWQBD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|