C20H42O6S2 — CID 150368887
1,1,1-triethoxy-2-(1,1,1-triethoxybutan-2-yldisulfanyl)butane (PubChem CID 150368887) has the molecular formula C20H42O6S2 and a molecular weight of 442.68 g/mol. Its IUPAC name is 1,1,1-triethoxy-2-(1,1,1-triethoxybutan-2-yldisulfanyl)butane.
| Compound Name | 1,1,1-triethoxy-2-(1,1,1-triethoxybutan-2-yldisulfanyl)butane |
|---|---|
| PubChem CID | 150368887 |
| Molecular Formula | C20H42O6S2 |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 1,1,1-triethoxy-2-(1,1,1-triethoxybutan-2-yldisulfanyl)butane |
| SMILES | CCOC(OCC)(OCC)C(CC)SSC(CC)C(OCC)(OCC)OCC |
| InChI | InChI=1S/C20H42O6S2/c1-9-17(19(21-11-3,22-12-4)23-13-5)27-28-18(10-2)20(24-14-6,25-15-7)26-16-8/h17-18H,9-16H2,1-8H3 |
| InChIKey | GXHKIZPLSQHHIF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|