C15H15ClN6O2S — CID 150373787
N-[4-[(3R)-3-[(5-chloropyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 150373787) has the molecular formula C15H15ClN6O2S and a molecular weight of 378.85 g/mol. Its IUPAC name is N-[4-[(3R)-3-[(5-chloropyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | N-[4-[(3R)-3-[(5-chloropyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 150373787 |
| Molecular Formula | C15H15ClN6O2S |
| Molecular Weight | 378.85 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | N-[4-[(3R)-3-[(5-chloropyrimidin-2-yl)amino]pyrrolidine-1-carbonyl]-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1nc(C(=O)N2CC[C@@H](Nc3ncc(Cl)cn3)C2)cs1 |
| InChI | InChI=1S/C15H15ClN6O2S/c1-2-12(23)21-15-20-11(8-25-15)13(24)22-4-3-10(7-22)19-14-17-5-9(16)6-18-14/h2,5-6,8,10H,1,3-4,7H2,(H,17,18,19)(H,20,21,23)/t10-/m1/s1 |
| InChIKey | GYGOEUUUEBBBSA-SNVBAGLBSA-N |
| XLogP | 2.04 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.85 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|