C20H22O5Si — CID 15037561
4-O-(2-acetyl-4-trimethylsilylphenyl) 1-O-methyl benzene-1,4-dicarboxylate (PubChem CID 15037561) has the molecular formula C20H22O5Si and a molecular weight of 370.48 g/mol. Its IUPAC name is 4-O-(2-acetyl-4-trimethylsilylphenyl) 1-O-methyl benzene-1,4-dicarboxylate.
| Compound Name | 4-O-(2-acetyl-4-trimethylsilylphenyl) 1-O-methyl benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 15037561 |
| Molecular Formula | C20H22O5Si |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 4-O-(2-acetyl-4-trimethylsilylphenyl) 1-O-methyl benzene-1,4-dicarboxylate |
| SMILES | COC(=O)c1ccc(C(=O)Oc2ccc([Si](C)(C)C)cc2C(C)=O)cc1 |
| InChI | InChI=1S/C20H22O5Si/c1-13(21)17-12-16(26(3,4)5)10-11-18(17)25-20(23)15-8-6-14(7-9-15)19(22)24-2/h6-12H,1-5H3 |
| InChIKey | MINQFGGGIBUDKT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|