C50H32F9N7O7S3 — CID 150376480
2,2,2-tris[2-(quinolin-8-ylsulfamoyl)-5-(trifluoromethyl)phenyl]acetamide (PubChem CID 150376480) has the molecular formula C50H32F9N7O7S3 and a molecular weight of 1110.03 g/mol. Its IUPAC name is 2,2,2-tris[2-(quinolin-8-ylsulfamoyl)-5-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2,2,2-tris[2-(quinolin-8-ylsulfamoyl)-5-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 150376480 |
| Molecular Formula | C50H32F9N7O7S3 |
| Molecular Weight | 1110.03 g/mol |
| Exact Mass | 1109.14 |
| IUPAC Name | 2,2,2-tris[2-(quinolin-8-ylsulfamoyl)-5-(trifluoromethyl)phenyl]acetamide |
| SMILES | NC(=O)C(c1cc(C(F)(F)F)ccc1S(=O)(=O)Nc1cccc2cccnc12)(c1cc(C(F)(F)F)ccc1S(=O)(=O)Nc1cccc2cccnc12)c1cc(C(F)(F)F)ccc1S(=O)(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C50H32F9N7O7S3/c51-48(52,53)31-16-19-40(74(68,69)64-37-13-1-7-28-10-4-22-61-43(28)37)34(25-31)47(46(60)67,35-26-32(49(54,55)56)17-20-41(35)75(70,71)65-38-14-2-8-29-11-5-23-62-44(29)38)36-27-33(50(57,58)59)18-21-42(36)76(72,73)66-39-15-3-9-30-12-6-24-63-45(30)39/h1-27,64-66H,(H2,60,67) |
| InChIKey | GYUQLVCGOAANJB-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 220.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1110.03 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|