C25H16Cl4N2O2 — CID 150381280
2-[(2,6-dichlorophenyl)methylideneamino]-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid (PubChem CID 150381280) has the molecular formula C25H16Cl4N2O2 and a molecular weight of 518.23 g/mol. Its IUPAC name is 2-[(2,6-dichlorophenyl)methylideneamino]-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid.
| Compound Name | 2-[(2,6-dichlorophenyl)methylideneamino]-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid |
|---|---|
| PubChem CID | 150381280 |
| Molecular Formula | C25H16Cl4N2O2 |
| Molecular Weight | 518.23 g/mol |
| Exact Mass | 516.00 |
| IUPAC Name | 2-[(2,6-dichlorophenyl)methylideneamino]-3-[2-(2,6-dichlorophenyl)quinolin-6-yl]propanoic acid |
| SMILES | O=C(O)C(Cc1ccc2nc(-c3c(Cl)cccc3Cl)ccc2c1)/N=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C25H16Cl4N2O2/c26-17-3-1-4-18(27)16(17)13-30-23(25(32)33)12-14-7-9-21-15(11-14)8-10-22(31-21)24-19(28)5-2-6-20(24)29/h1-11,13,23H,12H2,(H,32,33)/b30-13+ |
| InChIKey | GZUHFCZSZXYGPB-VVEOGCPPSA-N |
| XLogP | 7.63 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.23 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|