C26H18Cl4N2O3 — CID 69118593
methyl 3-(2,6-dichloroanilino)-2-[[2-(2,6-dichlorophenyl)quinolin-6-yl]methyl]-3-oxopropanoate (PubChem CID 69118593) has the molecular formula C26H18Cl4N2O3 and a molecular weight of 548.25 g/mol. Its IUPAC name is methyl 3-(2,6-dichloroanilino)-2-[[2-(2,6-dichlorophenyl)quinolin-6-yl]methyl]-3-oxopropanoate.
| Compound Name | methyl 3-(2,6-dichloroanilino)-2-[[2-(2,6-dichlorophenyl)quinolin-6-yl]methyl]-3-oxopropanoate |
|---|---|
| PubChem CID | 69118593 |
| Molecular Formula | C26H18Cl4N2O3 |
| Molecular Weight | 548.25 g/mol |
| Exact Mass | 546.01 |
| IUPAC Name | methyl 3-(2,6-dichloroanilino)-2-[[2-(2,6-dichlorophenyl)quinolin-6-yl]methyl]-3-oxopropanoate |
| SMILES | COC(=O)C(Cc1ccc2nc(-c3c(Cl)cccc3Cl)ccc2c1)C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C26H18Cl4N2O3/c1-35-26(34)16(25(33)32-24-19(29)6-3-7-20(24)30)13-14-8-10-21-15(12-14)9-11-22(31-21)23-17(27)4-2-5-18(23)28/h2-12,16H,13H2,1H3,(H,32,33) |
| InChIKey | XUYUJQQHIMJEAT-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.25 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|