C44H74O7 — CID 150391863
[(Z)-2-prop-2-enoyloxy-2-propylhexadec-9-enoyl] (Z)-2-prop-2-enoyloxy-2-propylhexadec-9-enoate (PubChem CID 150391863) has the molecular formula C44H74O7 and a molecular weight of 715.07 g/mol. Its IUPAC name is [(Z)-2-prop-2-enoyloxy-2-propylhexadec-9-enoyl] (Z)-2-prop-2-enoyloxy-2-propylhexadec-9-enoate.
| Compound Name | [(Z)-2-prop-2-enoyloxy-2-propylhexadec-9-enoyl] (Z)-2-prop-2-enoyloxy-2-propylhexadec-9-enoate |
|---|---|
| PubChem CID | 150391863 |
| Molecular Formula | C44H74O7 |
| Molecular Weight | 715.07 g/mol |
| Exact Mass | 714.54 |
| IUPAC Name | [(Z)-2-prop-2-enoyloxy-2-propylhexadec-9-enoyl] (Z)-2-prop-2-enoyloxy-2-propylhexadec-9-enoate |
| SMILES | C=CC(=O)OC(CCC)(CCCCCC/C=C\CCCCCC)C(=O)OC(=O)C(CCC)(CCCCCC/C=C\CCCCCC)OC(=O)C=C |
| InChI | InChI=1S/C44H74O7/c1-7-13-15-17-19-21-23-25-27-29-31-33-37-43(35-9-3,50-39(45)11-5)41(47)49-42(48)44(36-10-4,51-40(46)12-6)38-34-32-30-28-26-24-22-20-18-16-14-8-2/h11-12,21-24H,5-10,13-20,25-38H2,1-4H3/b23-21-,24-22- |
| InChIKey | HBWGGXLXCBYEQI-SXAUZNKPSA-N |
| XLogP | 12.33 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.07 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|