C7H9N3O4 — CID 150397041
2-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid (PubChem CID 150397041) has the molecular formula C7H9N3O4 and a molecular weight of 199.17 g/mol. Its IUPAC name is 2-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid.
| Compound Name | 2-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid |
|---|---|
| PubChem CID | 150397041 |
| Molecular Formula | C7H9N3O4 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 2-[(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)amino]acetic acid |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1NCC(=O)O |
| InChI | InChI=1S/C7H9N3O4/c1-3-5(8-2-4(11)12)6(13)10-7(14)9-3/h8H,2H2,1H3,(H,11,12)(H2,9,10,13,14) |
| InChIKey | HCYQTNUNMRYQLZ-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |