C31H34O — CID 150408596
4-(3-anthracen-1-ylprop-2-enyl)-2,6-ditert-butylphenol (PubChem CID 150408596) has the molecular formula C31H34O and a molecular weight of 422.61 g/mol. Its IUPAC name is 4-(3-anthracen-1-ylprop-2-enyl)-2,6-ditert-butylphenol.
| Compound Name | 4-(3-anthracen-1-ylprop-2-enyl)-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 150408596 |
| Molecular Formula | C31H34O |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | 4-(3-anthracen-1-ylprop-2-enyl)-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(CC=Cc2cccc3cc4ccccc4cc23)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C31H34O/c1-30(2,3)27-17-21(18-28(29(27)32)31(4,5)6)11-9-14-22-15-10-16-25-19-23-12-7-8-13-24(23)20-26(22)25/h7-10,12-20,32H,11H2,1-6H3 |
| InChIKey | HFHPQANSHBSMHM-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|