C14H28O7 — CID 150418593
2,2,3,3,5-pentaethoxy-1,4-dioxane (PubChem CID 150418593) has the molecular formula C14H28O7 and a molecular weight of 308.37 g/mol. Its IUPAC name is 2,2,3,3,5-pentaethoxy-1,4-dioxane.
| Compound Name | 2,2,3,3,5-pentaethoxy-1,4-dioxane |
|---|---|
| PubChem CID | 150418593 |
| Molecular Formula | C14H28O7 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 2,2,3,3,5-pentaethoxy-1,4-dioxane |
| SMILES | CCOC1COC(OCC)(OCC)C(OCC)(OCC)O1 |
| InChI | InChI=1S/C14H28O7/c1-6-15-12-11-20-13(16-7-2,17-8-3)14(21-12,18-9-4)19-10-5/h12H,6-11H2,1-5H3 |
| InChIKey | HHHJLGTUANIZSW-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|