C39H38F2N10O5 — CID 150421786
2,4-bis[4-(4-fluorophenyl)piperazin-1-yl]-1,5-bis(5-nitroindazol-1-yl)pentan-3-one (PubChem CID 150421786) has the molecular formula C39H38F2N10O5 and a molecular weight of 764.79 g/mol. Its IUPAC name is 2,4-bis[4-(4-fluorophenyl)piperazin-1-yl]-1,5-bis(5-nitroindazol-1-yl)pentan-3-one.
| Compound Name | 2,4-bis[4-(4-fluorophenyl)piperazin-1-yl]-1,5-bis(5-nitroindazol-1-yl)pentan-3-one |
|---|---|
| PubChem CID | 150421786 |
| Molecular Formula | C39H38F2N10O5 |
| Molecular Weight | 764.79 g/mol |
| Exact Mass | 764.30 |
| IUPAC Name | 2,4-bis[4-(4-fluorophenyl)piperazin-1-yl]-1,5-bis(5-nitroindazol-1-yl)pentan-3-one |
| SMILES | O=C(C(Cn1ncc2cc([N+](=O)[O-])ccc21)N1CCN(c2ccc(F)cc2)CC1)C(Cn1ncc2cc([N+](=O)[O-])ccc21)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C39H38F2N10O5/c40-29-1-5-31(6-2-29)44-13-17-46(18-14-44)37(25-48-35-11-9-33(50(53)54)21-27(35)23-42-48)39(52)38(26-49-36-12-10-34(51(55)56)22-28(36)24-43-49)47-19-15-45(16-20-47)32-7-3-30(41)4-8-32/h1-12,21-24,37-38H,13-20,25-26H2 |
| InChIKey | HHYCYKZOBHAKQS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 151.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.79 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|