C36H48N8O8 — CID 159579307
tert-butyl 4-[(5-nitroindazol-1-yl)methyl]piperidine-1-carboxylate;tert-butyl 4-[(5-nitroindazol-2-yl)methyl]piperidine-1-carboxylate (PubChem CID 159579307) has the molecular formula C36H48N8O8 and a molecular weight of 720.83 g/mol. Its IUPAC name is tert-butyl 4-[(5-nitroindazol-1-yl)methyl]piperidine-1-carboxylate;tert-butyl 4-[(5-nitroindazol-2-yl)methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(5-nitroindazol-1-yl)methyl]piperidine-1-carboxylate;tert-butyl 4-[(5-nitroindazol-2-yl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 159579307 |
| Molecular Formula | C36H48N8O8 |
| Molecular Weight | 720.83 g/mol |
| Exact Mass | 720.36 |
| IUPAC Name | tert-butyl 4-[(5-nitroindazol-1-yl)methyl]piperidine-1-carboxylate;tert-butyl 4-[(5-nitroindazol-2-yl)methyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Cn2cc3cc([N+](=O)[O-])ccc3n2)CC1.CC(C)(C)OC(=O)N1CCC(Cn2ncc3cc([N+](=O)[O-])ccc32)CC1 |
| InChI | InChI=1S/2C18H24N4O4/c1-18(2,3)26-17(23)20-8-6-13(7-9-20)12-21-16-5-4-15(22(24)25)10-14(16)11-19-21;1-18(2,3)26-17(23)20-8-6-13(7-9-20)11-21-12-14-10-15(22(24)25)4-5-16(14)19-21/h4-5,10-11,13H,6-9,12H2,1-3H3;4-5,10,12-13H,6-9,11H2,1-3H3 |
| InChIKey | MIURIQZPVIICAU-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 181.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.83 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|